CAS 2098496-89-8 is the registry number for S-9-Fluorenylmethyl-l-cysteine tert-butyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoate;hydrochloride (CAS 2098496-89-8) is a chemical compound with the molecular formula C21H26ClNO2S and a molecular weight of 392.0 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoate;hydrochloride. InChIKey: KPTMNHBEXLJQBX-FYZYNONXSA-N.
| Molecular formula | C21H26ClNO2S |
|---|---|
| Molecular weight | 392.0 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoate;hydrochloride |
| InChIKey | KPTMNHBEXLJQBX-FYZYNONXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CSCC1C2=CC=CC=C2C3=CC=CC=C13)N.Cl |
Computed by PubChem (NCBI)