CAS 2098497-30-2 appears in our catalog under these names: N-Boc-6-azido-L-norleucine Cyclohexylammonium Salt, Boc-L-Lys(N3)-OH*CHA, Boc- Lys(N3)-OH·CHA, Boc-L-Lys(N3)-OH (CHA), Boc-L-Lys(N3)-OH CHA, 95%. Offered by: TRC, Iris Biotech, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 1g, 5g, 25g, 0,25g, 0,5g.
(2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;cyclohexanamine (CAS 2098497-30-2) is a chemical compound with the molecular formula C17H33N5O4 and a molecular weight of 371.5 g/mol. IUPAC name: (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;cyclohexanamine. InChIKey: NHHYBEBTGVUZET-QRPNPIFTSA-N.
| Molecular formula | C17H33N5O4 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2S)-6-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;cyclohexanamine |
| InChIKey | NHHYBEBTGVUZET-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O.C1CCC(CC1)N |
Computed by PubChem (NCBI)