CAS 2098537-67-6 is the registry number for 4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-2-trifluoromethoxy-benzoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate (CAS 2098537-67-6) is a chemical compound with the molecular formula C16H20BF3O5 and a molecular weight of 360.1 g/mol. IUPAC name: ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate. InChIKey: LDMKNXCUGIANSA-UHFFFAOYSA-N.
| Molecular formula | C16H20BF3O5 |
|---|---|
| Molecular weight | 360.1 g/mol |
| IUPAC name | ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate |
| InChIKey | LDMKNXCUGIANSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OCC)OC(F)(F)F |
Computed by PubChem (NCBI)