CAS 2121515-17-9 is the registry number for Ethyl 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate (CAS 2121515-17-9) is a chemical compound with the molecular formula C16H20BF3O5 and a molecular weight of 360.1 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate. InChIKey: LSLYULZWVCURCK-UHFFFAOYSA-N.
| Molecular formula | C16H20BF3O5 |
|---|---|
| Molecular weight | 360.1 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)benzoate |
| InChIKey | LSLYULZWVCURCK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC(F)(F)F)C(=O)OCC |
Computed by PubChem (NCBI)