Products 2098545-89-0
CAS 2098545-89-0 is the registry number for CEE321. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2-chloroanilino)-6-[(6-methyl-2-pyridinyl)amino]pyridine-3-carboxamide (CAS 2098545-89-0) is a chemical compound with the molecular formula C18H16ClN5O and a molecular weight of 353.8 g/mol. IUPAC name: 4-(2-chloroanilino)-6-[(6-methyl-2-pyridinyl)amino]pyridine-3-carboxamide. InChIKey: OYWNKAAPXTYEBN-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN5O |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 4-(2-chloroanilino)-6-[(6-methyl-2-pyridinyl)amino]pyridine-3-carboxamide |
| InChIKey | OYWNKAAPXTYEBN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC2=NC=C(C(=C2)NC3=CC=CC=C3Cl)C(=O)N |
Computed by PubChem (NCBI)