Products 2098794-95-5

CAS 2098794-95-5 is the registry number for 1-(Difluoromethyl)-1H-imidazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(difluoromethyl)imidazole-4-carboxylic acid (CAS 2098794-95-5) is a chemical compound with the molecular formula C5H4F2N2O2 and a molecular weight of 162.09 g/mol. IUPAC name: 1-(difluoromethyl)imidazole-4-carboxylic acid. InChIKey: WHISGEJHNNSDQN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4F2N2O2
Molecular weight162.09 g/mol
IUPAC name1-(difluoromethyl)imidazole-4-carboxylic acid
InChIKeyWHISGEJHNNSDQN-UHFFFAOYSA-N
SMILESC1=C(N=CN1C(F)F)C(=O)O

Computed by PubChem (NCBI)