CAS 2098799-12-1 appears in our catalog under these names: 4-(4-Amino-3-(4-amino-3-fluorophenoxy)phenoxy)-N-methylpicolinamide, 98%, Regorafenib Impurity 15, Regorafenib Impurity 10, Regorafenib Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-amino-3-(4-amino-3-fluorophenoxy)phenoxy]-N-methylpyridine-2-carboxamide (CAS 2098799-12-1) is a chemical compound with the molecular formula C19H17FN4O3 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-amino-3-(4-amino-3-fluorophenoxy)phenoxy]-N-methylpyridine-2-carboxamide. InChIKey: OARKLXQVLMBBKI-UHFFFAOYSA-N.
| Molecular formula | C19H17FN4O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[4-amino-3-(4-amino-3-fluorophenoxy)phenoxy]-N-methylpyridine-2-carboxamide |
| InChIKey | OARKLXQVLMBBKI-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)N)OC3=CC(=C(C=C3)N)F |
Computed by PubChem (NCBI)