CAS 20988-85-6 appears in our catalog under these names: 3-Phenyl-4-thioxo-3,4-dihydrophthalazine-1-carboxylic acid, 95%, 3-Phenyl-4-thioxo-3,4-dihydrophthalazine-1-carboxylic acid, 97%, 3–phenyl–4–thioxo–3，4–dihydrophthalazine–1–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
3-phenyl-4-sulfanylidenephthalazine-1-carboxylic acid (CAS 20988-85-6) is a chemical compound with the molecular formula C15H10N2O2S and a molecular weight of 282.3 g/mol. IUPAC name: 3-phenyl-4-sulfanylidenephthalazine-1-carboxylic acid. InChIKey: KNXTVOBGGOILAT-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2S |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 3-phenyl-4-sulfanylidenephthalazine-1-carboxylic acid |
| InChIKey | KNXTVOBGGOILAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=S)C3=CC=CC=C3C(=N2)C(=O)O |
Computed by PubChem (NCBI)