Products 2098902-68-0
CAS 2098902-68-0 appears in our catalog under these names: KDM4D-IN-1/ 100%, KDM4D–IN–1, KDM4D-IN-1, KDM4D-IN-1, 98.82%, KDM4D-IN-1 (Standard). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
4-methyl-8-oxo-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-5-carbonitrile (CAS 2098902-68-0) is a chemical compound with the molecular formula C11H7N5O and a molecular weight of 225.21 g/mol. IUPAC name: 4-methyl-8-oxo-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-5-carbonitrile. InChIKey: FIRSAIIBSBCBTF-UHFFFAOYSA-N.
| Molecular formula | C11H7N5O |
|---|---|
| Molecular weight | 225.21 g/mol |
| IUPAC name | 4-methyl-8-oxo-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-5-carbonitrile |
| InChIKey | FIRSAIIBSBCBTF-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1C#N)NC(=O)C3=C2N=CC=C3 |
Computed by PubChem (NCBI)