CAS 2098914-55-5 is the registry number for 1,3-Bis(3,5-dimethylbenzyl)-5,6-dimethyl-1H-benzo[d]imidazol-3-ium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-bis[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazol-3-ium bromide (CAS 2098914-55-5) is a chemical compound with the molecular formula C27H31BrN2 and a molecular weight of 463.5 g/mol. IUPAC name: 1,3-bis[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazol-3-ium bromide. InChIKey: DMEBIRYJLXGSAA-UHFFFAOYSA-M.
| Molecular formula | C27H31BrN2 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 1,3-bis[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazol-3-ium bromide |
| InChIKey | DMEBIRYJLXGSAA-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC(=C1)CN2C=[N+](C3=C2C=C(C(=C3)C)C)CC4=CC(=CC(=C4)C)C)C.[Br-] |
Computed by PubChem (NCBI)