CAS 2099017-71-5 is the registry number for Ethyl 3-iodo-7-isopropyl-1H-indole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-iodo-7-propan-2-yl-1H-indole-2-carboxylate (CAS 2099017-71-5) is a chemical compound with the molecular formula C14H16INO2 and a molecular weight of 357.19 g/mol. IUPAC name: ethyl 3-iodo-7-propan-2-yl-1H-indole-2-carboxylate. InChIKey: GWDVVYNUEVRVFC-UHFFFAOYSA-N.
| Molecular formula | C14H16INO2 |
|---|---|
| Molecular weight | 357.19 g/mol |
| IUPAC name | ethyl 3-iodo-7-propan-2-yl-1H-indole-2-carboxylate |
| InChIKey | GWDVVYNUEVRVFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C(=CC=C2)C(C)C)I |
Computed by PubChem (NCBI)