CAS 2099033-66-4 appears in our catalog under these names: Tafluprost Impurity 9, Latanoprost Impurity 18, (E)-Latanoprostene Bunod. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-nitrooxybutyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (CAS 2099033-66-4) is a chemical compound with the molecular formula C27H41NO8 and a molecular weight of 507.6 g/mol. IUPAC name: 4-nitrooxybutyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate. InChIKey: LOVMMUBRQUFEAH-LMDVOQDDSA-N.
| Molecular formula | C27H41NO8 |
|---|---|
| Molecular weight | 507.6 g/mol |
| IUPAC name | 4-nitrooxybutyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| InChIKey | LOVMMUBRQUFEAH-LMDVOQDDSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H]1O)C/C=C/CCCC(=O)OCCCCO[N+](=O)[O-])CC[C@H](CCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)