Products 209913-88-2
CAS 209913-88-2 is the registry number for L-NMMA (citrate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 209913-88-2) is a chemical compound with the molecular formula C13H24N4O9 and a molecular weight of 380.35 g/mol. IUPAC name: (2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: YKWLPIRSUICUFT-JEDNCBNOSA-N.
| Molecular formula | C13H24N4O9 |
|---|---|
| Molecular weight | 380.35 g/mol |
| IUPAC name | (2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | YKWLPIRSUICUFT-JEDNCBNOSA-N |
| SMILES | CN=C(N)NCCC[C@@H](C(=O)O)N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)