CAS 209917-93-1 is the registry number for Berotralstat Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-cyanophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 209917-93-1) is a chemical compound with the molecular formula C12H6F3N3O2 and a molecular weight of 281.19 g/mol. IUPAC name: 1-(3-cyanophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: FQVUSLUPETYVCP-UHFFFAOYSA-N.
| Molecular formula | C12H6F3N3O2 |
|---|---|
| Molecular weight | 281.19 g/mol |
| IUPAC name | 1-(3-cyanophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| InChIKey | FQVUSLUPETYVCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=CC(=N2)C(F)(F)F)C(=O)O)C#N |
Computed by PubChem (NCBI)