Products 209960-58-7

CAS 209960-58-7 is the registry number for Piraxostat Impurity 41. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(3-cyano-4-fluorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 209960-58-7) is a chemical compound with the molecular formula C12H5F4N3O2 and a molecular weight of 299.18 g/mol. IUPAC name: 1-(3-cyano-4-fluorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: JJNADBOHSHJDJK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H5F4N3O2
Molecular weight299.18 g/mol
IUPAC name1-(3-cyano-4-fluorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid
InChIKeyJJNADBOHSHJDJK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N2C(=CC(=N2)C(F)(F)F)C(=O)O)C#N)F

Computed by PubChem (NCBI)