CAS 209984-56-5 appears in our catalog under these names: YO–01027 (Dibenzazepine, DBZ), Dibenzazepine (Deshydroxy LY 411575), >95% (HPLC), YO-01027/ 99.63% (existing batch purity), gamma-Secretase Inhibitor XX , DBZ. Offered by: GLPBio, TRC, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5mg, 10mg, 1mg, 2mg, 25mg, 50mg, 10mM (in 1ml dmso), 3mg.
(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(7S)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanamide (CAS 209984-56-5) is a chemical compound with the molecular formula C26H23F2N3O3 and a molecular weight of 463.5 g/mol. IUPAC name: (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(7S)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanamide. InChIKey: QSHGISMANBKLQL-OWJWWREXSA-N.
| Molecular formula | C26H23F2N3O3 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(7S)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanamide |
| InChIKey | QSHGISMANBKLQL-OWJWWREXSA-N |
| SMILES | C[C@@H](C(=O)N[C@H]1C2=CC=CC=C2C3=CC=CC=C3N(C1=O)C)NC(=O)CC4=CC(=CC(=C4)F)F |
Computed by PubChem (NCBI)