CAS 2100306-53-2 appears in our catalog under these names: Bis-PEG4-t-butyl ester, Bis–PEG4–t–butyl ester, Bis-PEG4-t-butyl ester 97%, Di-tert-butyl 4,7,10,13-tetraoxahexadecanedioate, 97%, 97%, Bis-PEG4-t-butyl ester, 97.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g.
Tert-butyl 3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2100306-53-2) is a chemical compound with the molecular formula C20H38O8 and a molecular weight of 406.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: BEMRKFMWPQHBBR-UHFFFAOYSA-N.
| Molecular formula | C20H38O8 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | BEMRKFMWPQHBBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)