CAS 2100306-71-4 appears in our catalog under these names: Bromo-peg3-ch2co2tbu, 95%, Bromo-PEG3-CH2-Boc, Bromo–PEG3–CH2–Boc, Bromo-PEG3-CH2-Boc 95%, tert-Butyl 2-(2-(2-(2-bromoethoxy)ethoxy)ethoxy)acetate, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 5mg, 10mg, 50mg, 10g, 1g, 5g.
Tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate (CAS 2100306-71-4) is a chemical compound with the molecular formula C12H23BrO5 and a molecular weight of 327.21 g/mol. IUPAC name: tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate. InChIKey: WDLOTPAWUBQPND-UHFFFAOYSA-N.
| Molecular formula | C12H23BrO5 |
|---|---|
| Molecular weight | 327.21 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]acetate |
| InChIKey | WDLOTPAWUBQPND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCBr |
Computed by PubChem (NCBI)