CAS 2100306-73-6 appears in our catalog under these names: Benzyloxy carbonyl-peg3-acid, 95%, Benzyloxy carbonyl–PEG3–C2–acid, Benzyloxy carbonyl-peg3-acid 98%, Benzyloxy carbonyl-PEG3-acid, 98%, 98%, Benzyloxy carbonyl-PEG3-C2-acid. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 250 mg, 100 mg, 50 mg.
3-[2-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]ethoxy]propanoic acid (CAS 2100306-73-6) is a chemical compound with the molecular formula C17H24O7 and a molecular weight of 340.4 g/mol. IUPAC name: 3-[2-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]ethoxy]propanoic acid. InChIKey: XTVQHJQMAHLFTN-UHFFFAOYSA-N.
| Molecular formula | C17H24O7 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-[2-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | XTVQHJQMAHLFTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)