CAS 2100306-80-5 appears in our catalog under these names: Hydroxy-peg5-methyl ester, 95%, Hydroxy-PEG5-C2-methyl ester, Hydroxy–PEG5–C2–methyl ester, Hydroxy-peg5-methyl ester 95%, Methyl 18-hydroxy-4,7,10,13,16-pentaoxaoctadecanoate, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
Methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2100306-80-5) is a chemical compound with the molecular formula C14H28O8 and a molecular weight of 324.37 g/mol. IUPAC name: methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZUAYQXPIWZRYOC-UHFFFAOYSA-N.
| Molecular formula | C14H28O8 |
|---|---|
| Molecular weight | 324.37 g/mol |
| IUPAC name | methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZUAYQXPIWZRYOC-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)