CAS 2100306-81-6 appears in our catalog under these names: NH–bis(C2–PEG1–azide), 2-(2-Azidoethoxy)-N-[2-(2-azidoethoxy)ethyl]ethanamine, 98%, 98%, NH-bis(C2-PEG1-azide), 99.87%, NH-bis(C2-PEG1-azide), 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 100 mg, 250 mg, 50 mg.
2-(2-azidoethoxy)-N-[2-(2-azidoethoxy)ethyl]ethanamine (CAS 2100306-81-6) is a chemical compound with the molecular formula C8H17N7O2 and a molecular weight of 243.27 g/mol. IUPAC name: 2-(2-azidoethoxy)-N-[2-(2-azidoethoxy)ethyl]ethanamine. InChIKey: FXMWPZQWEUFICE-UHFFFAOYSA-N.
| Molecular formula | C8H17N7O2 |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | 2-(2-azidoethoxy)-N-[2-(2-azidoethoxy)ethyl]ethanamine |
| InChIKey | FXMWPZQWEUFICE-UHFFFAOYSA-N |
| SMILES | C(COCCN=[N+]=[N-])NCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)