CAS 210036-05-8 is the registry number for 2'-OMe-4'-ODMT-5'-NO2 phenoxybutyric acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-methoxy-5-nitrophenoxy]butanoic acid (CAS 210036-05-8) is a chemical compound with the molecular formula C33H33NO9 and a molecular weight of 587.6 g/mol. IUPAC name: 4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-methoxy-5-nitrophenoxy]butanoic acid. InChIKey: XBPJMUSBTASKIX-UHFFFAOYSA-N.
| Molecular formula | C33H33NO9 |
|---|---|
| Molecular weight | 587.6 g/mol |
| IUPAC name | 4-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
| InChIKey | XBPJMUSBTASKIX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4=CC(=C(C=C4[N+](=O)[O-])OCCCC(=O)O)OC |
Computed by PubChem (NCBI)