CAS 210049-17-5 is the registry number for 2-Aminophenyl beta-d-glucuronide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid;hydrochloride (CAS 210049-17-5) is a chemical compound with the molecular formula C12H16ClNO7 and a molecular weight of 321.71 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid;hydrochloride. InChIKey: URGDEQRHHDUHCP-BLKPXHQLSA-N.
| Molecular formula | C12H16ClNO7 |
|---|---|
| Molecular weight | 321.71 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid;hydrochloride |
| InChIKey | URGDEQRHHDUHCP-BLKPXHQLSA-N |
| SMILES | C1=CC=C(C(=C1)N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O.Cl |
Computed by PubChem (NCBI)