Products 210098-00-3

CAS 210098-00-3 is the registry number for 2,5-dichloro-4-methylthiophene-3-carbaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2,5-dichloro-4-methylthiophene-3-carbaldehyde (CAS 210098-00-3) is a chemical compound with the molecular formula C6H4Cl2OS and a molecular weight of 195.07 g/mol. IUPAC name: 2,5-dichloro-4-methylthiophene-3-carbaldehyde. InChIKey: IMEAGLDWAUYNLF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl2OS
Molecular weight195.07 g/mol
IUPAC name2,5-dichloro-4-methylthiophene-3-carbaldehyde
InChIKeyIMEAGLDWAUYNLF-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1C=O)Cl)Cl

Computed by PubChem (NCBI)