CAS 2101206-60-2 appears in our catalog under these names: Perfluorophenyl 3-(2-(2-(4-formylbenzamido)ethoxy)ethoxy)propanoate, 98%, Ald–Ph–amido–PEG2–C2–Pfp ester, Ald-Ph-amido-PEG2-C2-Pfp ester 95%, Ald-Ph-amido-PEG2-C2-Pfp ester. Offered by: Chemat Brand, GLPBio, Ambeed, MedChemExpress. Available pack sizes: on request, 100mg, 500mg, 250mg, 1g, 50 mg, 100 mg, 25 mg.
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate (CAS 2101206-60-2) is a chemical compound with the molecular formula C21H18F5NO6 and a molecular weight of 475.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate. InChIKey: TZCKVEZMOMYKNG-UHFFFAOYSA-N.
| Molecular formula | C21H18F5NO6 |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate |
| InChIKey | TZCKVEZMOMYKNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(=O)NCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)