CAS 2101206-79-3 is the registry number for tert-Butyl 3,3-difluoro-4-hydroxy-4-(trifluoromethyl)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Tert-butyl 3,3-difluoro-4-hydroxy-4-(trifluoromethyl)piperidine-1-carboxylate (CAS 2101206-79-3) is a chemical compound with the molecular formula C11H16F5NO3 and a molecular weight of 305.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-hydroxy-4-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: IXYHNGDUMGISFM-UHFFFAOYSA-N.
| Molecular formula | C11H16F5NO3 |
|---|---|
| Molecular weight | 305.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-hydroxy-4-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | IXYHNGDUMGISFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)