Products 2101230-88-8
CAS 2101230-88-8 is the registry number for HC-1310. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-bromoquinolin-4-yl)sulfanyl-2-ethylbutanoic acid (CAS 2101230-88-8) is a chemical compound with the molecular formula C15H16BrNO2S and a molecular weight of 354.3 g/mol. IUPAC name: 2-(6-bromoquinolin-4-yl)sulfanyl-2-ethylbutanoic acid. InChIKey: XHMUXJZYLFPHTF-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO2S |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | 2-(6-bromoquinolin-4-yl)sulfanyl-2-ethylbutanoic acid |
| InChIKey | XHMUXJZYLFPHTF-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C(=O)O)SC1=C2C=C(C=CC2=NC=C1)Br |
Computed by PubChem (NCBI)