Products 2101429-50-7
CAS 2101429-50-7 is the registry number for 1-(3-(2-Hydroxyethyl)phenyl)guanidine methanesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(2-hydroxyethyl)phenyl]guanidine;methanesulfonic acid (CAS 2101429-50-7) is a chemical compound with the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. IUPAC name: 2-[3-(2-hydroxyethyl)phenyl]guanidine;methanesulfonic acid. InChIKey: QVLOWMGDWVDEPJ-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O4S |
|---|---|
| Molecular weight | 275.33 g/mol |
| IUPAC name | 2-[3-(2-hydroxyethyl)phenyl]guanidine;methanesulfonic acid |
| InChIKey | QVLOWMGDWVDEPJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CC(=C1)N=C(N)N)CCO |
Computed by PubChem (NCBI)