CAS 210155-53-6 appears in our catalog under these names: N2,N6-Bis(2,6-diisopropylphenyl)pyridine-2,6-dicarboxamide, 95%, N2,N6-Bis(2,6-Diisopropylphenyl)Pyridine-2,6-Dicarboxamide, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboxamide (CAS 210155-53-6) is a chemical compound with the molecular formula C31H39N3O2 and a molecular weight of 485.7 g/mol. IUPAC name: 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboxamide. InChIKey: NSJYUOHQHJBSOE-UHFFFAOYSA-N.
| Molecular formula | C31H39N3O2 |
|---|---|
| Molecular weight | 485.7 g/mol |
| IUPAC name | 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboxamide |
| InChIKey | NSJYUOHQHJBSOE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)C2=NC(=CC=C2)C(=O)NC3=C(C=CC=C3C(C)C)C(C)C |
Computed by PubChem (NCBI)