Products 2101629-97-2
CAS 2101629-97-2 is the registry number for 3-(2-hydroxypropan-2-yl)cyclobutyl 4-methylbenzene-1-sulfonate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[3-(2-hydroxypropan-2-yl)cyclobutyl] 4-methylbenzenesulfonate (CAS 2101629-97-2) is a chemical compound with the molecular formula C14H20O4S and a molecular weight of 284.37 g/mol. IUPAC name: [3-(2-hydroxypropan-2-yl)cyclobutyl] 4-methylbenzenesulfonate. InChIKey: CYQCEQQWYPAMCT-UHFFFAOYSA-N.
| Molecular formula | C14H20O4S |
|---|---|
| Molecular weight | 284.37 g/mol |
| IUPAC name | [3-(2-hydroxypropan-2-yl)cyclobutyl] 4-methylbenzenesulfonate |
| InChIKey | CYQCEQQWYPAMCT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC(C2)C(C)(C)O |
Computed by PubChem (NCBI)