Products 2101633-95-6
CAS 2101633-95-6 is the registry number for 4-(5,7-di-tert-butylbenzo[d]oxazol-2-yl)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)benzonitrile (CAS 2101633-95-6) is a chemical compound with the molecular formula C22H24N2O and a molecular weight of 332.4 g/mol. IUPAC name: 4-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)benzonitrile. InChIKey: QLMLCSGTPRITSP-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-(5,7-ditert-butyl-1,3-benzoxazol-2-yl)benzonitrile |
| InChIKey | QLMLCSGTPRITSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C2C(=C1)N=C(O2)C3=CC=C(C=C3)C#N)C(C)(C)C |
Computed by PubChem (NCBI)