Products 2101636-53-5

CAS 2101636-53-5 is the registry number for 4,4'-(Anthracene-9,10-diyl)bis(2-aminobenzoic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-4-[10-(3-amino-4-carboxyphenyl)anthracen-9-yl]benzoic acid (CAS 2101636-53-5) is a chemical compound with the molecular formula C28H20N2O4 and a molecular weight of 448.5 g/mol. IUPAC name: 2-amino-4-[10-(3-amino-4-carboxyphenyl)anthracen-9-yl]benzoic acid. InChIKey: QIVVQXQKYWFGJX-UHFFFAOYSA-N.

Identity
Molecular formulaC28H20N2O4
Molecular weight448.5 g/mol
IUPAC name2-amino-4-[10-(3-amino-4-carboxyphenyl)anthracen-9-yl]benzoic acid
InChIKeyQIVVQXQKYWFGJX-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC(=C(C=C4)C(=O)O)N)C5=CC(=C(C=C5)C(=O)O)N

Computed by PubChem (NCBI)