CAS 2101658-56-2 appears in our catalog under these names: 6–Bromo–8–iodoquinolin–2(1H)–one, 6-Bromo-8-iodoquinolin-2(1H)-one, 98%. Offered by: GLPBio, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-8-iodo-1H-quinolin-2-one (CAS 2101658-56-2) is a chemical compound with the molecular formula C9H5BrINO and a molecular weight of 349.95 g/mol. IUPAC name: 6-bromo-8-iodo-1H-quinolin-2-one. InChIKey: ALQIQLXWVABRAF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrINO |
|---|---|
| Molecular weight | 349.95 g/mol |
| IUPAC name | 6-bromo-8-iodo-1H-quinolin-2-one |
| InChIKey | ALQIQLXWVABRAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C=C(C=C21)Br)I |
Computed by PubChem (NCBI)