CAS 2102-15-0 appears in our catalog under these names: Benzonitrile-D5, >95% (HPLC), Benzonitrile-d5, 99 atom % D, min 98% Chemical Purity, BENZONITRILE-D5, 99 ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 0,5g.
2,3,4,5,6-pentadeuteriobenzonitrile (CAS 2102-15-0) is a chemical compound with the molecular formula C7H5N and a molecular weight of 108.15 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriobenzonitrile. InChIKey: JFDZBHWFFUWGJE-RALIUCGRSA-N.
| Molecular formula | C7H5N |
|---|---|
| Molecular weight | 108.15 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriobenzonitrile |
| InChIKey | JFDZBHWFFUWGJE-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C#N)[2H])[2H] |
Computed by PubChem (NCBI)