Products 2102162-79-6
CAS 2102162-79-6 is the registry number for Nintedanib Impurity 56. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3Z)-2-oxo-3-[phenyl(piperidin-1-yl)methylidene]-1H-indole-6-carboxylate (CAS 2102162-79-6) is a chemical compound with the molecular formula C22H22N2O3 and a molecular weight of 362.4 g/mol. IUPAC name: methyl (3Z)-2-oxo-3-[phenyl(piperidin-1-yl)methylidene]-1H-indole-6-carboxylate. InChIKey: ZVCZWEDHEMVPPV-VXPUYCOJSA-N.
| Molecular formula | C22H22N2O3 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | methyl (3Z)-2-oxo-3-[phenyl(piperidin-1-yl)methylidene]-1H-indole-6-carboxylate |
| InChIKey | ZVCZWEDHEMVPPV-VXPUYCOJSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)/C(=C(\C3=CC=CC=C3)/N4CCCCC4)/C(=O)N2 |
Computed by PubChem (NCBI)