Products 2102350-92-3
CAS 2102350-92-3 appears in our catalog under these names: (S)-3-(Isocyanatomethyl)-5-methylhexanoic acid, 95%, Pregabalin Impurity 57, Pregabalin Impurity 77, Pregabalin Impurity 82. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3S)-3-(isocyanatomethyl)-5-methylhexanoic acid (CAS 2102350-92-3) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: (3S)-3-(isocyanatomethyl)-5-methylhexanoic acid. InChIKey: GRZPGJWQKHHQTO-QMMMGPOBSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (3S)-3-(isocyanatomethyl)-5-methylhexanoic acid |
| InChIKey | GRZPGJWQKHHQTO-QMMMGPOBSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)O)CN=C=O |
Computed by PubChem (NCBI)