Products 2102408-57-9
CAS 2102408-57-9 appears in our catalog under these names: (3R)-6-Fluoro-2,3-dihydrobenzo[b]furan-3-ylamine hydrochloride, 95%, (R)–6–Fluoro–2，3–dihydrobenzofuran–3–amine hydrochloride, (R)-6-Fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2102408-57-9) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: HFKQYAVAOPSXSI-FJXQXJEOSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | HFKQYAVAOPSXSI-FJXQXJEOSA-N |
| SMILES | C1[C@@H](C2=C(O1)C=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)