CAS 2102409-01-6 is the registry number for TERT-BUTYL 4-(TRIFLUOROMETHOXY)PYRIDIN-2-YLCARBAMATE, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate (CAS 2102409-01-6) is a chemical compound with the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. IUPAC name: tert-butyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate. InChIKey: HDRYQJMHUYHQJR-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O3 |
|---|---|
| Molecular weight | 278.23 g/mol |
| IUPAC name | tert-butyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate |
| InChIKey | HDRYQJMHUYHQJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)OC(F)(F)F |
Computed by PubChem (NCBI)