CAS 2102409-31-2 appears in our catalog under these names: 5-Fluoroquinolin-6-amine, 95%, 5-Fluoroquinolin-6-amine, 97%, 97%, 5-FLUOROQUINOLIN-6-AMINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g.
5-fluoroquinolin-6-amine (CAS 2102409-31-2) is a chemical compound with the molecular formula C9H7FN2 and a molecular weight of 162.16 g/mol. IUPAC name: 5-fluoroquinolin-6-amine. InChIKey: LCIMDZVLQQSHAK-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 5-fluoroquinolin-6-amine |
| InChIKey | LCIMDZVLQQSHAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2F)N)N=C1 |
Computed by PubChem (NCBI)