Products 2102410-88-6
CAS 2102410-88-6 appears in our catalog under these names: (3R)-4-Fluoro-2,3-dihydrobenzo[b]furan-3-ylamine hydrochloride, 95%, (R)-4-Fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(3R)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2102410-88-6) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (3R)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: UYHZWXUWYDOLLQ-RGMNGODLSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (3R)-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | UYHZWXUWYDOLLQ-RGMNGODLSA-N |
| SMILES | C1[C@@H](C2=C(O1)C=CC=C2F)N.Cl |
Computed by PubChem (NCBI)