Products 2102411-79-8
CAS 2102411-79-8 is the registry number for 3-Bromo-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 2102411-79-8) is a chemical compound with the molecular formula C9H3BrF6N2 and a molecular weight of 333.03 g/mol. IUPAC name: 3-bromo-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: HEGZSMJYAKOLMD-UHFFFAOYSA-N.
| Molecular formula | C9H3BrF6N2 |
|---|---|
| Molecular weight | 333.03 g/mol |
| IUPAC name | 3-bromo-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | HEGZSMJYAKOLMD-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=C2Br)C(F)(F)F)C=C1C(F)(F)F |
Computed by PubChem (NCBI)