CAS 2102411-80-1 appears in our catalog under these names: 6-Quinolinamine, 7-fluoro-, 98%, 98%, 7-FLUOROQUINOLIN-6-AMINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-fluoroquinolin-6-amine (CAS 2102411-80-1) is a chemical compound with the molecular formula C9H7FN2 and a molecular weight of 162.16 g/mol. IUPAC name: 7-fluoroquinolin-6-amine. InChIKey: NAQGBWDTPWLTFB-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 7-fluoroquinolin-6-amine |
| InChIKey | NAQGBWDTPWLTFB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)F)N |
Computed by PubChem (NCBI)