CAS 2102412-20-2 appears in our catalog under these names: tert-Butyl 3,3-difluoro-1,6-diazaspiro[3.3]heptane-1-carboxylate hydrochloride, 95%, tert-Butyl 3,3-difluoro-1,6-diazaspiro(3.3)heptane-1-carboxylate hydrochloride, 97%, 1,6-Diazaspiro[3.3]heptane-1-carboxylic acid, 3,3-difluoro-, 1,1-dimethylethyl ester, hydrochloride (1:1), 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 500mg.
Tert-butyl 3,3-difluoro-1,6-diazaspiro[3.3]heptane-1-carboxylate;hydrochloride (CAS 2102412-20-2) is a chemical compound with the molecular formula C10H17ClF2N2O2 and a molecular weight of 270.70 g/mol. IUPAC name: tert-butyl 3,3-difluoro-1,6-diazaspiro[3.3]heptane-1-carboxylate;hydrochloride. InChIKey: RBEQQMVGVCDOOB-UHFFFAOYSA-N.
| Molecular formula | C10H17ClF2N2O2 |
|---|---|
| Molecular weight | 270.70 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-1,6-diazaspiro[3.3]heptane-1-carboxylate;hydrochloride |
| InChIKey | RBEQQMVGVCDOOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C12CNC2)(F)F.Cl |
Computed by PubChem (NCBI)