CAS 2102501-84-6 appears in our catalog under these names: Ketohexokinase inhibitor 1/ 99.45% (existing batch purity), Ketohexokinase inhibitor 1, PF-06835919, 99.53%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[(1R,5S)-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid (CAS 2102501-84-6) is a chemical compound with the molecular formula C16H19F3N4O2 and a molecular weight of 356.34 g/mol. IUPAC name: 2-[(1R,5S)-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid. InChIKey: MDUYWDNWFXSMJJ-OFLUOSHYSA-N.
| Molecular formula | C16H19F3N4O2 |
|---|---|
| Molecular weight | 356.34 g/mol |
| IUPAC name | 2-[(1R,5S)-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]acetic acid |
| InChIKey | MDUYWDNWFXSMJJ-OFLUOSHYSA-N |
| SMILES | C[C@H]1CCN1C2=NC(=CC(=N2)N3C[C@@H]4[C@H](C3)C4CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)