CAS 2102517-30-4 is the registry number for Potassium 2,2-difluoro-4,5-dioxo-1,3,2-dioxaborolan-2-uide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione (CAS 2102517-30-4) is a chemical compound with the molecular formula C2BF2NaO4 and a molecular weight of 159.82 g/mol. IUPAC name: sodium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione. InChIKey: HRRQLROHUSYBRX-UHFFFAOYSA-N.
| Molecular formula | C2BF2NaO4 |
|---|---|
| Molecular weight | 159.82 g/mol |
| IUPAC name | sodium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione |
| InChIKey | HRRQLROHUSYBRX-UHFFFAOYSA-N |
| SMILES | [B-]1(OC(=O)C(=O)O1)(F)F.[Na+] |
Computed by PubChem (NCBI)