CAS 2102525-51-7 is the registry number for 2,2'-(Pyridine-2,6-diyl)diterephthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[6-(2,5-dicarboxyphenyl)-2-pyridinyl]terephthalic acid (CAS 2102525-51-7) is a chemical compound with the molecular formula C21H13NO8 and a molecular weight of 407.3 g/mol. IUPAC name: 2-[6-(2,5-dicarboxyphenyl)-2-pyridinyl]terephthalic acid. InChIKey: ATFATVISUIEMEN-UHFFFAOYSA-N.
| Molecular formula | C21H13NO8 |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | 2-[6-(2,5-dicarboxyphenyl)-2-pyridinyl]terephthalic acid |
| InChIKey | ATFATVISUIEMEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C2=C(C=CC(=C2)C(=O)O)C(=O)O)C3=C(C=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)