CAS 2102672-22-8 appears in our catalog under these names: DK419, 99%, DK419/ 98.15% (existing batch purity), DK419, DK419, 99.86%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 100 mg.
6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide (CAS 2102672-22-8) is a chemical compound with the molecular formula C16H8ClF6N3O and a molecular weight of 407.70 g/mol. IUPAC name: 6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide. InChIKey: MWNNIGRGNSXNEA-UHFFFAOYSA-N.
| Molecular formula | C16H8ClF6N3O |
|---|---|
| Molecular weight | 407.70 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide |
| InChIKey | MWNNIGRGNSXNEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)C2=C3C(=CC(=C2)Cl)NC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)