CAS 2102881-54-7 is the registry number for 3-(5-Bromo-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(5-bromo-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 2102881-54-7) is a chemical compound with the molecular formula C20H18BrNO4 and a molecular weight of 416.3 g/mol. IUPAC name: (E)-3-(5-bromo-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: CFCUEULONZGZSD-QPJJXVBHSA-N.
| Molecular formula | C20H18BrNO4 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | (E)-3-(5-bromo-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | CFCUEULONZGZSD-QPJJXVBHSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)/C=C/C2=CNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)