CAS 2102950-42-3 is the registry number for Moxifloxacin Impurity 163. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,7aS)-6-benzyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (CAS 2102950-42-3) is a chemical compound with the molecular formula C14H20N2 and a molecular weight of 216.32 g/mol. IUPAC name: (4aR,7aS)-6-benzyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine. InChIKey: AFYZAHZKOFBVLE-ZIAGYGMSSA-N.
| Molecular formula | C14H20N2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (4aR,7aS)-6-benzyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| InChIKey | AFYZAHZKOFBVLE-ZIAGYGMSSA-N |
| SMILES | C1C[C@@H]2CN(C[C@H]2NC1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)