CAS 2102955-00-8 is the registry number for Rel-tert-butyl (2R,6S)-4-amino-2,6-dimethylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,6S)-4-amino-2,6-dimethylpiperidine-1-carboxylate (CAS 2102955-00-8) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (2R,6S)-4-amino-2,6-dimethylpiperidine-1-carboxylate. InChIKey: UWNNQBIGNFPJRP-ULKQDVFKSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (2R,6S)-4-amino-2,6-dimethylpiperidine-1-carboxylate |
| InChIKey | UWNNQBIGNFPJRP-ULKQDVFKSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1C(=O)OC(C)(C)C)C)N |
Computed by PubChem (NCBI)